CymitQuimica logo

CAS 1154-72-9

:

1-(2,3,4-trihydroxyphenyl)decan-1-one

Description:
1-(2,3,4-trihydroxyphenyl)decan-1-one, also known by its CAS number 1154-72-9, is an organic compound characterized by a long aliphatic chain and a phenolic structure. This compound features a decanone backbone, which is a ten-carbon chain with a ketone functional group at one end, and a phenolic moiety with three hydroxyl groups at the 2, 3, and 4 positions on the aromatic ring. The presence of multiple hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity, particularly in redox reactions. The compound may exhibit antioxidant properties due to the phenolic structure, making it of interest in various biological and pharmaceutical applications. Additionally, its hydrophobic decanone chain may influence its interaction with biological membranes and its overall bioavailability. Overall, 1-(2,3,4-trihydroxyphenyl)decan-1-one is a compound of interest in both synthetic organic chemistry and potential therapeutic applications.
Formula:C16H24O4
InChI:InChI=1/C16H24O4/c1-2-3-4-5-6-7-8-9-13(17)12-10-11-14(18)16(20)15(12)19/h10-11,18-20H,2-9H2,1H3
SMILES:CCCCCCCCCC(=O)c1ccc(c(c1O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.