CAS 115404-57-4
:Niloticin
Description:
Niloticin, with the CAS number 115404-57-4, is a chemical compound that has garnered interest due to its potential biological activities. It is classified as a natural product, specifically an alkaloid, which is derived from certain plant sources. Niloticin exhibits a complex molecular structure that contributes to its unique properties. The compound has been studied for its pharmacological effects, including antimicrobial and anti-inflammatory activities, making it a subject of interest in medicinal chemistry. Its mechanism of action may involve interactions with specific biological targets, although detailed studies are necessary to fully elucidate these pathways. Additionally, niloticin's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and therapeutic contexts. As research continues, niloticin may reveal further applications in drug development and therapeutic interventions, highlighting the importance of natural products in modern pharmacology.
Formula:C30H48O3
InChI:InChI=1S/C30H48O3/c1-18(17-22(31)25-27(4,5)33-25)19-11-15-30(8)21-9-10-23-26(2,3)24(32)13-14-28(23,6)20(21)12-16-29(19,30)7/h9,18-20,22-23,25,31H,10-17H2,1-8H3/t18-,19-,20-,22+,23-,25-,28+,29-,30+/m0/s1
InChI key:InChIKey=GKQMMZUXYRXFOH-QBLSGNHRSA-N
SMILES:C[C@@]12C=3[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])(CC[C@@]1(C)[C@]([C@H](C[C@@H](O)[C@]5(C(C)(C)O5)[H])C)(CC2)[H])[H]
Synonyms:- (13α,14β,17α,20S,23R,24S)-24,25-Epoxy-23-hydroxylanost-7-en-3-one
- Lanost-7-en-3-one, 24,25-epoxy-23-hydroxy-, (13α,14β,17α,20S,23R,24S)-
- Niloticin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lanost-7-en-3-one, 24,25-epoxy-23-hydroxy-, (13α,14β,17α,20S,23R,24S)-
CAS:Formula:C30H48O3Purity:98.0%Color and Shape:SolidMolecular weight:456.7003Niloticin
CAS:<p>Niloticin is a mosquito insecticide from Limonia acidissima L.</p>Formula:C30H48O3Purity:98%Color and Shape:SolidMolecular weight:456.711Niloticin
CAS:<p>Niloticin is a natural compound, which is a limonoid extracted from the seeds of plants in the Meliaceae family. It exhibits potential bioactivity through mechanisms including the inhibition of specific enzymes and interference with cellular pathways, which are crucial in various biological processes. Niloticin has shown promise in research focused on its antifeedant, antimicrobial, and anticancer properties. Its applications are being explored in agricultural settings for pest management and in medical fields for developing novel therapeutic agents. By targeting specific molecular pathways, it offers an opportunity for advancements in both crop protection and pharmacological research. As an emerging compound of interest, Niloticin continues to be a subject of study for its diverse range of bioactivities and potential implementations in scientific and practical domains.</p>Formula:C30H48O3Purity:Min. 95%Molecular weight:456.7 g/mol



