CymitQuimica logo

CAS 115416-38-1

:

5-(Biotinamido)pentylamine

Description:
5-(Biotinamido)pentylamine, also known as biotinylated pentylamine, is a chemical compound characterized by its biotin moiety, which is a vitamin B7 derivative known for its role in various biological processes, including carboxylation reactions and as a coenzyme. This compound features a pentylamine chain, which contributes to its hydrophobic properties, enhancing its ability to interact with lipid membranes and proteins. The presence of the biotin group allows for specific binding to avidin or streptavidin, making it a valuable tool in biochemical assays and molecular biology applications, such as protein labeling and purification. The compound is typically used in research settings, particularly in studies involving protein interactions, cellular targeting, and drug delivery systems. Its solubility in organic solvents and moderate stability under physiological conditions make it suitable for various experimental protocols. Overall, 5-(Biotinamido)pentylamine is a versatile reagent in the field of biochemistry and molecular biology, facilitating the study of biomolecular interactions and cellular processes.
Formula:C15H28N4O2S
InChI:InChI=1/C15H28N4O2S/c16-8-4-1-5-9-17-13(20)7-3-2-6-12-14-11(10-22-12)18-15(21)19-14/h11-12,14H,1-10,16H2,(H,17,20)(H2,18,19,21)/t11-,12-,14-/m0/s1
InChI key:CCSGGWGTGOLEHK-OBJOEFQTSA-N
SMILES:C(CCN)CCN=C(CCCC[C@H]1[C@@H]2[C@H](CS1)N=C(N2)O)O
Synonyms:
  • Biotinyl cadaverine
  • N-(5-aminopentyl)-5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanamide
Found 9 products.