CAS 115416-49-4

3-{[4-nitro-2-(trifluoromethyl)phenyl]amino}propan-1-ol

Description:

3-{[4-nitro-2-(trifluoromethyl)phenyl]amino}propan-1-ol, with the CAS number 115416-49-4, is an organic compound characterized by its complex structure, which includes a propanol backbone, an amino group, and a nitro-substituted aromatic ring. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its nitro group contributes to its potential reactivity and may affect its electronic properties, making it of interest in various chemical and pharmaceutical applications. The compound's unique combination of functional groups suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, handling and usage should be approached with caution due to the presence of the nitro group, which can be associated with toxicity and environmental concerns.

Formula: C₁₀H₁₁F₃N₂O₃

InChI: InChI=1/C10H11F3N2O3/c11-10(12,13)8-6-7(15(17)18)2-3-9(8)14-4-1-5-16/h2-3,6,14,16H,1,4-5H2

SMILES: C(CNc1ccc(cc1C(F)(F)F)N(=O)=O)CO

3-((4-Nitro-2-(trifluoromethyl)phenyl)amino)propan-1-ol

CAS: 115416-49-4

Formula: C₁₀H₁₁F₃N₂O₃

Molecular weight: 264.2011

Ref: IN-DA000FZ8