CAS 115416-53-0
:Nitropyridylphenylalaninol; 98%
Description:
Nitropyridylphenylalaninol, with the CAS number 115416-53-0, is a chemical compound that features a pyridine ring substituted with a nitro group and is linked to a phenylalaninol moiety. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural properties. The presence of the nitro group can influence the compound's reactivity and biological activity, while the phenylalaninol component may contribute to its ability to interact with biological targets. Typically, compounds like nitropyridylphenylalaninol are evaluated for their solubility, stability, and potential toxicity, which are crucial for their application in drug development. The designation "98%" indicates a high level of purity, suggesting that the substance is suitable for research and development purposes. As with many organic compounds, proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C14H15N3O3
InChI:InChI=1/C14H15N3O3/c18-10-12(8-11-4-2-1-3-5-11)16-14-7-6-13(9-15-14)17(19)20/h1-7,9,12,18H,8,10H2,(H,15,16)/t12-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](CO)Nc1ccc(cn1)N(=O)=O
Synonyms:- (S)-N-(5-Nitro-2-pyridyl)phenylalaninol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-2-((5-Nitropyridin-2-yl)amino)-3-phenylpropan-1-ol
CAS:Formula:C14H15N3O3Molecular weight:273.2872
