CAS 115422-59-8
:1-Butoxy-2-methoxy-4-(1-propen-1-yl)benzene
Description:
1-Butoxy-2-methoxy-4-(1-propen-1-yl)benzene, with the CAS number 115422-59-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of both butoxy and methoxy groups indicates that it is an ether, contributing to its solubility in organic solvents. The propenyl group introduces unsaturation, which can affect its reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate volatility and may have a relatively low boiling point compared to heavier aromatic compounds. Its structure suggests potential uses in the fragrance industry or as an intermediate in the synthesis of more complex organic molecules. Additionally, the presence of multiple substituents can influence its physical properties, such as polarity and hydrophobicity, which are important for its behavior in different chemical environments. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-4-6-10-16-13-9-8-12(7-5-2)11-14(13)15-3/h5,7-9,11H,4,6,10H2,1-3H3
InChI key:InChIKey=VTCAIAGLQULXQO-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCCCC)C=CC(C=CC)=C1
Synonyms:- Benzene, 1-butoxy-2-methoxy-4-(1-propen-1-yl)-
- 1-(4-Butoxy-3-methoxyphenyl)propene
- 1-Butoxy-2-methoxy-4-(1-propen-1-yl)benzene
- Benzene, 1-butoxy-2-methoxy-4-(1-propenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
