
CAS 115436-73-2
:Ipazilide
Description:
Ipazilide, with the CAS number 115436-73-2, is a chemical compound that belongs to the class of substances known as antipsychotics. It is primarily characterized by its ability to interact with various neurotransmitter receptors in the brain, particularly those associated with dopamine and serotonin pathways. This interaction is crucial for its pharmacological effects, which include the modulation of mood and behavior. Ipazilide is typically administered in a clinical setting for the treatment of certain psychiatric disorders. Its chemical structure features specific functional groups that contribute to its biological activity and pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, like many pharmaceuticals, ipazilide may exhibit side effects, which necessitate careful monitoring during treatment. Research into its efficacy and safety profile continues to evolve, contributing to a better understanding of its role in mental health therapies. As with any medication, it is essential to use ipazilide under the guidance of a qualified healthcare professional.
Formula:C24H30N4O
InChI:InChI=1S/C24H30N4O/c1-3-27(4-2)17-11-16-25-23(29)19-28-24(21-14-9-6-10-15-21)22(18-26-28)20-12-7-5-8-13-20/h5-10,12-15,18H,3-4,11,16-17,19H2,1-2H3,(H,25,29)
InChI key:InChIKey=PRHCHMGCDBUACR-UHFFFAOYSA-N
SMILES:C(C(NCCCN(CC)CC)=O)N1C(=C(C=N1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- N-[3-(Diethylamino)propyl]-4,5-diphenyl-1H-pyrazole-1-acetamide
- Ipazilide
- 1H-Pyrazole-1-acetamide, N-[3-(diethylamino)propyl]-4,5-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.