CAS 115453-82-2
:7-ethoxy-4-(trifluoromethyl)coumarin
Description:
7-Ethoxy-4-(trifluoromethyl)coumarin is a synthetic organic compound belonging to the coumarin family, characterized by its distinct aromatic structure and functional groups. This compound features an ethoxy group at the 7-position and a trifluoromethyl group at the 4-position of the coumarin ring, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. Coumarins are known for their fluorescence properties, and this particular derivative may exhibit unique photophysical characteristics, making it useful in various applications, including as a fluorescent probe in biochemical assays. Additionally, the compound may possess potential pharmacological activities, although specific biological effects would depend on further empirical studies. Overall, 7-ethoxy-4-(trifluoromethyl)coumarin represents a versatile structure with potential applications in research and industry, particularly in the fields of organic synthesis and medicinal chemistry.
Formula:C12H9F3O3
InChI:InChI=1/C12H9F3O3/c1-2-17-7-3-4-8-9(12(13,14)15)6-11(16)18-10(8)5-7/h3-6H,2H2,1H3
SMILES:CCOc1ccc2c(cc(=O)oc2c1)C(F)(F)F
Synonyms:- 7-Ethoxy-4-trifluoromethylcoumarin
- 7-Ethoxy-4-(trifluoromethyl)-2H-1-benzypyran-2-one
- Etfc cpd
- 2H-1-Benzopyran-2-one, 7-ethoxy-4-(trifluoromethyl)-
- 7-ethoxy-4-(trifluoromethyl)-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2H-1-Benzopyran-2-one, 7-ethoxy-4-(trifluoromethyl)-
CAS:Formula:C12H9F3O3Purity:95%Color and Shape:SolidMolecular weight:258.19337-Ethoxy-4-(trifluoromethyl)coumarin
CAS:7-Ethoxy-4-(trifluoromethyl)coumarinPurity:97%Molecular weight:258.19g/mol7-Ethoxy-4-(trifluoromethyl)coumarin
CAS:7-Ethoxy-4-(trifluoromethyl)coumarin is a substrate for Cytochrome P450 enzyme and is involved in metabolism, fluorescent.Formula:C12H9F3O3Color and Shape:White PowderMolecular weight:258.197-Ethoxy-4-(trifluoromethyl)coumarin
CAS:Controlled ProductApplications 7-Ethoxy-4-(trifluoromethyl)coumarin is a fluorogenic substrate used for determining cytochrome P450 activity.
References DeLuca, J.G., et al. Biochem. Pharmacol. 37, 1731, (1988)Formula:C12H9F3O3Color and Shape:Light RedMolecular weight:258.19





