CymitQuimica logo

CAS 115453-88-8

:

2-Bromo-3-methoxybutanenitrile

Description:
2-Bromo-3-methoxybutanenitrile is an organic compound characterized by its functional groups, including a bromine atom, a methoxy group, and a nitrile group. The presence of the bromine atom indicates that it is a halogenated compound, which can influence its reactivity and potential applications in organic synthesis. The methoxy group (-OCH3) contributes to the compound's polarity and can affect its solubility in various solvents. The nitrile group (-C≡N) is known for its ability to participate in nucleophilic reactions and can serve as a precursor for various chemical transformations. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests that it may exhibit moderate to high reactivity, making it useful in synthetic organic chemistry, particularly in the formation of carbon-carbon bonds or as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound due to the presence of bromine and its potential toxicity.
Formula:C5H8BrNO
InChI:InChI=1S/C5H8BrNO/c1-4(8-2)5(6)3-7/h4-5H,1-2H3
InChI key:InChIKey=VQNOASUBEMUUNF-UHFFFAOYSA-N
SMILES:C(C(OC)C)(C#N)Br
Synonyms:
  • 2-Bromo-3-methoxybutanenitrile
  • Butanenitrile, 2-bromo-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.