CAS 1154623-10-5

N-[4-(Methylamino)cyclohexyl]acetamide

Description:

N-[4-(Methylamino)cyclohexyl]acetamide, identified by its CAS number 1154623-10-5, is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. This substance features a cyclohexyl ring substituted with a methylamino group, contributing to its structural complexity and possibly influencing its pharmacological properties. The presence of the acetamide moiety suggests that it may exhibit interactions typical of amides, such as hydrogen bonding, which can affect solubility and reactivity. The compound's molecular structure implies that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its unique configuration may result in distinct physical properties, such as melting and boiling points, which are essential for understanding its behavior in various environments. As with many organic compounds, safety and handling precautions are necessary, as the biological effects and toxicity profiles would need to be thoroughly evaluated in any practical applications.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-7(12)11-9-5-3-8(10-2)4-6-9/h8-10H,3-6H2,1-2H3,(H,11,12)

InChI key: InChIKey=LWVNJCHQJBWIKU-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1CCC(NC)CC1

Synonyms:

• Acetamide, N-[4-(methylamino)cyclohexyl]-
• N-[4-(Methylamino)cyclohexyl]acetamide

N-[4-(Methylamino)cyclohexyl]acetamide

CAS: 1154623-10-5

Versatile small molecule scaffold

Formula: C₉H₁₈N₂O

Purity: Min. 95%

Molecular weight: 170.25 g/mol

Ref: 3D-EWB62310