
CAS 115464-38-5
:(3E,5E)-2,7-Dimethyl-3,5-octadiene
Description:
(3E,5E)-2,7-Dimethyl-3,5-octadiene is an organic compound characterized by its diene structure, featuring two double bonds located at the 3rd and 5th carbon positions of an octane backbone. The presence of two methyl groups at the 2nd and 7th positions contributes to its branched nature, influencing its physical and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct odor, indicative of its unsaturated hydrocarbon nature. It is relatively non-polar, which affects its solubility in various solvents, being more soluble in organic solvents than in water. The double bonds in the structure make it reactive, particularly in addition reactions, and it may participate in polymerization processes. Its specific reactivity and stability can be influenced by factors such as temperature and the presence of catalysts. As a compound of interest in organic synthesis and potentially in fragrance formulations, (3E,5E)-2,7-Dimethyl-3,5-octadiene exemplifies the diverse chemistry of aliphatic dienes.
Formula:C10H18
InChI:InChI=1S/C10H18/c1-9(2)7-5-6-8-10(3)4/h5-10H,1-4H3/b7-5+,8-6+
InChI key:InChIKey=FPZPWGSFHQXVRT-KQQUZDAGSA-N
SMILES:C(\C=C\C(C)C)=C/C(C)C
Synonyms:- 3,5-Octadiene, 2,7-dimethyl-, (3E,5E)-
- (3E,5E)-2,7-Dimethyl-3,5-octadiene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
