CAS 115464-77-2
:1-(7-Benzofuranyl)-4-[[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl]piperazine
Description:
1-(7-Benzofuranyl)-4-[[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl]piperazine, with the CAS number 115464-77-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzofuran moiety, a piperazine ring, and a pyrrole derivative. This compound typically exhibits properties associated with its heterocyclic components, such as potential biological activity and interactions with various receptors. The presence of the fluorophenyl group may enhance lipophilicity, influencing its pharmacokinetic profile. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As with many synthetic compounds, safety and handling precautions are essential, as they may exhibit toxicity or other hazardous properties. Further studies, including in vitro and in vivo evaluations, are necessary to fully understand its biological effects and therapeutic potential.
Formula:C23H22FN3O
InChI:InChI=1S/C23H22FN3O/c24-19-6-4-17(5-7-19)21-9-8-20(25-21)16-26-11-13-27(14-12-26)22-3-1-2-18-10-15-28-23(18)22/h1-10,15,25H,11-14,16H2
InChI key:InChIKey=PGNHBJGIQAEIHD-UHFFFAOYSA-N
SMILES:C(N1CCN(C2=C3C(=CC=C2)C=CO3)CC1)C=4NC(=CC4)C5=CC=C(F)C=C5
Synonyms:- 1-(1-benzofuran-7-yl)-4-{[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl}piperazine
- 1-(7-Benzofuranyl)-4-((5-(p-fluorophenyl)pyrrol-2-yl)methyl)piperazine
- 1-(7-Benzofuranyl)-4-[[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl]piperazine
- Du 29894
- Elopiprazole [INN]
- Piperazine, 1-(7-benzofuranyl)-4-[[5-(4-fluorophenyl)-1H-pyrrol-2-yl]methyl]-
- Unii-419A0R564U
- Elopiprazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Elopiprazole
CAS:Elopiprazole(DU 29840) is an anti-neurological compound that can be used to study neurological disorders.Formula:C23H22FN3OPurity:99.53% - >99.99%Color and Shape:SolidMolecular weight:375.44Elopiprazole
CAS:Elopiprazole is a 5-HT1A receptor antagonist that has been shown to be effective in the treatment of psychosis and depression. It is a prodrug that is converted into elopiprant in the body by esterases, which inhibits H3 acetylation and thereby prevents transcription of inflammatory bowel disease. Elopiprazole has been shown to have no effect on 5-ht2a receptors, dopamine receptors, or histone h3 acetylation. The drug also has a molecular structure similar to the active form of clozapine (clozapine N-oxide), which is known for its high affinity for dopamine receptors. This may explain why elopiprazole has anti-psychotic effects.
Purity:Min. 95%



