CAS 115464-89-6
:2-(3-Chlorophenyl)-1H-pyrrole
Description:
2-(3-Chlorophenyl)-1H-pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 3-chlorophenyl group at the second position of the pyrrole ring significantly influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents due to its aromatic nature, while its chlorinated phenyl group can enhance its lipophilicity. The chlorine atom introduces electronegativity, which can affect the compound's electronic distribution and reactivity, making it potentially useful in various chemical reactions, including electrophilic substitutions. Additionally, compounds like 2-(3-Chlorophenyl)-1H-pyrrole may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C10H8ClN
InChI:InChI=1S/C10H8ClN/c11-9-4-1-3-8(7-9)10-5-2-6-12-10/h1-7,12H
InChI key:InChIKey=HOXQAKYIVLKWTB-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C2=CC=CN2
Synonyms:- 2-(3′-Chlorophenyl)opyrrole
- 1H-Pyrrole, 2-(3-chlorophenyl)-
- 2-(3-Chlorophenyl)-1H-pyrrole
- 2-(3-Chlorophenyl)pyrrole
- NSC 116793
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
