CAS 115466-97-2

1-(4-Ethoxyphenyl)-2,2,3,3,3-pentafluoro-1-propanone

Description:

1-(4-Ethoxyphenyl)-2,2,3,3,3-pentafluoro-1-propanone, with CAS number 115466-97-2, is an organic compound characterized by its unique structure that includes a phenyl group substituted with an ethoxy group and a pentafluoropropanone moiety. This compound is notable for its high fluorine content, which imparts distinct chemical properties such as increased lipophilicity and thermal stability. The presence of the ethoxy group enhances its solubility in organic solvents, making it useful in various chemical applications. Additionally, the pentafluoropropanone structure contributes to its reactivity, particularly in electrophilic substitution reactions. The compound may exhibit interesting biological activities due to its unique functional groups, making it a subject of interest in medicinal chemistry and materials science. Its synthesis typically involves multi-step organic reactions, and it is important to handle it with care due to potential toxicity associated with fluorinated compounds. Overall, this substance represents a fascinating example of fluorinated organic chemistry with potential applications in diverse fields.

Formula: C₁₁H₉F₅O₂

InChI: InChI=1S/C11H9F5O2/c1-2-18-8-5-3-7(4-6-8)9(17)10(12,13)11(14,15)16/h3-6H,2H2,1H3

InChI key: InChIKey=QDRZLSLQHKCKRU-UHFFFAOYSA-N

SMILES: C(C(C(F)(F)F)(F)F)(=O)C1=CC=C(OCC)C=C1

Synonyms:

• 1-Propanone, 1-(4-ethoxyphenyl)-2,2,3,3,3-pentafluoro-
• 1-(4-Ethoxyphenyl)-2,2,3,3,3-pentafluoro-1-propanone