CAS 115473-61-5
:leiocarpaquinone
Description:
Leiocarpaquinone, with the CAS number 115473-61-5, is a naturally occurring compound classified as a quinone. It is derived from certain plant sources and is known for its potential biological activities. Characteristically, leiocarpaquinone exhibits a distinct yellow to orange color, which is typical of many quinones due to their conjugated double bond systems. This compound is soluble in organic solvents, reflecting its hydrophobic nature, and may show varying solubility in polar solvents. Leiocarpaquinone has garnered interest in the field of medicinal chemistry due to its reported antioxidant and antimicrobial properties, making it a subject of research for potential therapeutic applications. Its structure features a bicyclic framework, which contributes to its reactivity and interaction with biological molecules. As with many quinones, it may participate in redox reactions, influencing cellular processes. However, detailed studies on its pharmacological effects and mechanisms of action are still ongoing, highlighting the need for further exploration of its potential benefits and applications in various fields, including pharmaceuticals and natural product chemistry.
Formula:C17H12O6
InChI:InChI=1/C17H12O6/c1-7-3-4-9-12(14(7)19)16(21)8-5-6-10(18)13(17(22)23-2)11(8)15(9)20/h3-6,18-19H,1-2H3
Synonyms:- methyl 2,5-dihydroxy-6-methyl-9,10-dioxo-9,10-dihydroanthracene-1-carboxylate
- 1-Anthracenecarboxylic acid, 9,10-dihydro-2,5-dihydroxy-6-methyl-9,10-dioxo-, methyl ester
- Leiocarpaquinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Anthracenecarboxylic acid, 9,10-dihydro-2,5-dihydroxy-6-methyl-9,10-dioxo-, methyl ester
CAS:Formula:C17H12O6Molecular weight:312.2736Leiocarpaquinone
CAS:Leiocarpaquinone is a bioactive chemical from root of Uentilago leiocarpa Benth. (Rhamnaceae).Formula:C17H12O6Purity:98%Color and Shape:SolidMolecular weight:312.27

