CAS 115473-63-7
:rupestonic acid
Description:
Rupestonic acid, identified by its CAS number 115473-63-7, is a chemical compound that belongs to the class of organic acids. It is characterized by its unique molecular structure, which includes functional groups that contribute to its acidic properties. This compound is typically derived from natural sources and may exhibit biological activity, making it of interest in various fields such as pharmacology and biochemistry. Rupestonic acid may possess specific solubility characteristics, often being soluble in polar solvents, which can influence its reactivity and interactions with other substances. Additionally, its stability under different environmental conditions can vary, impacting its potential applications. While detailed studies on its specific properties, such as melting point, boiling point, and spectral data, may be limited, ongoing research may provide further insights into its behavior and potential uses in scientific and industrial applications. As with any chemical substance, safety data and handling precautions are essential for its use in laboratory or industrial settings.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-4-5-11(9(2)15(17)18)6-13-10(3)14(16)7-12(8)13/h8,11-12H,2,4-7H2,1,3H3,(H,17,18)/t8-,11-,12-/m0/s1
SMILES:C[C@H]1CC[C@@H](CC2=C(C)C(=O)C[C@@H]12)C(=C)C(=O)O
Synonyms:- 5-Azuleneacetic acid, 1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-alpha-methylene-2-oxo-, (5S-(5alpha,8beta,8aalpha))-
- 2-[(5S,8S,8aS)-3,8-dimethyl-2-oxo-1,2,4,5,6,7,8,8a-octahydroazulen-5-yl]prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Rupestonic acid
CAS:Rupestonic acid is a compound in Artemisia rupestris L., a well-known traditional Uighur medicine for the treatment of colds.Formula:C15H20O3Purity:99.95%Color and Shape:SolidMolecular weight:248.32Rupestonic acid
CAS:<p>Rupestonic acid is a naturally occurring diterpenoid compound, which is predominantly isolated from plants belonging to the genus Isodon. This bioactive compound is primarily sourced from traditional medicinal herbs that are native to regions in Asia, where such plants have been utilized for centuries in folk medicine.</p>Formula:C15H20O3Purity:Min. 95%Molecular weight:248.32 g/mol



