CAS 1154740-69-8

6-Chloro-3-methyl-2-(2-propen-1-yl)phenol

Description:

6-Chloro-3-methyl-2-(2-propen-1-yl)phenol, identified by its CAS number 1154740-69-8, is an organic compound characterized by its phenolic structure, which includes a chlorine atom and a propenyl group. This compound features a chloro substituent at the 6-position and a methyl group at the 3-position of the phenolic ring, contributing to its unique reactivity and potential applications. The presence of the propenyl group enhances its ability to participate in various chemical reactions, making it a candidate for use in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Its phenolic nature suggests it may exhibit antioxidant properties, and the chlorine substituent can influence its biological activity and solubility. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Safety data and handling precautions should be considered due to the presence of chlorine and the potential for reactivity.

Formula: C₁₀H₁₁ClO

InChI: InChI=1S/C10H11ClO/c1-3-4-8-7(2)5-6-9(11)10(8)12/h3,5-6,12H,1,4H2,2H3

InChI key: InChIKey=VTTFYBYYQZKMOM-UHFFFAOYSA-N

SMILES: C(C=C)C1=C(O)C(Cl)=CC=C1C

Synonyms:

• 6-Chloro-3-methyl-2-(2-propen-1-yl)phenol
• 2-Allyl-6-chloro-3-methylphenol
• 6-Chloro-3-methyl-2-(prop-2-en-1-yl)phenol
• Phenol, 6-chloro-3-methyl-2-(2-propen-1-yl)-