CAS 1154740-88-1
:7-Chloro-2,3-dihydro-6-methoxy-1H-inden-1-one
Description:
7-Chloro-2,3-dihydro-6-methoxy-1H-inden-1-one is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety. The presence of a chlorine atom at the 7-position and a methoxy group at the 6-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic nature. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the indene framework is often associated with various biological activities. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), would be essential for further characterization and understanding its behavior in different chemical environments. Additionally, safety data and handling precautions should be considered, as with any chemical substance, to ensure safe laboratory practices.
Formula:C10H9ClO2
InChI:InChI=1S/C10H9ClO2/c1-13-8-5-3-6-2-4-7(12)9(6)10(8)11/h3,5H,2,4H2,1H3
InChI key:InChIKey=GJLZXZRCJHPTHR-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC=C1OC)CCC2=O
Synonyms:- 7-Chloro-2,3-dihydro-6-methoxy-1H-inden-1-one
- 1H-Inden-1-one, 7-chloro-2,3-dihydro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
