CAS 1154742-52-5

7-Bromo-4-(trifluoromethoxy)-1H-indole

Description:

7-Bromo-4-(trifluoromethoxy)-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 7-position and a trifluoromethoxy group at the 4-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. The trifluoromethoxy group imparts unique electronic properties, enhancing the compound's potential as a pharmaceutical intermediate or in material science applications. Additionally, the bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 7-Bromo-4-(trifluoromethoxy)-1H-indole is a versatile compound with applications in research and development.

Formula: C₉H₅BrF₃NO

InChI: InChI=1S/C9H5BrF3NO/c10-6-1-2-7(15-9(11,12)13)5-3-4-14-8(5)6/h1-4,14H

InChI key: InChIKey=JMRYMSXORBJNKW-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C2C(=C(Br)C=C1)NC=C2

Synonyms:

• 1H-Indole, 7-bromo-4-(trifluoromethoxy)-
• 7-Bromo-4-(trifluoromethoxy)-1H-indole