CAS 115479-42-0
:4-Methoxy-7--D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine
Description:
4-Methoxy-7-D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine is a chemical compound that belongs to the class of pyrrolopyrimidines, which are characterized by a fused pyrrole and pyrimidine ring structure. This compound features a methoxy group and a ribofuranosyl moiety, indicating it has both aromatic and sugar components, which may contribute to its biological activity. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry. Its structural features may influence its solubility, stability, and interaction with biological targets, such as enzymes or receptors. The compound's CAS number, 115479-42-0, allows for precise identification in chemical databases and literature. Overall, this substance may exhibit unique pharmacological properties, making it a candidate for further research in drug development or biochemical applications. However, specific characteristics such as melting point, boiling point, and spectral data would require experimental determination or literature reference for comprehensive understanding.
Formula:C12H16N4O5
InChI:InChI=1/C12H16N4O5/c1-20-10-5-2-3-16(9(5)14-12(13)15-10)11-8(19)7(18)6(4-17)21-11/h2-3,6-8,11,17-19H,4H2,1H3,(H2,13,14,15)/t6-,7+,8+,11-/m1/s1
Synonyms:- 2-Amino-4-methoxy-7--D-ribofuranosylpyrrolo[2,3-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 4-methoxy-7-β-D-ribofuranosyl-
CAS:Formula:C12H16N4O5Color and Shape:SolidMolecular weight:296.2792
