CAS 115491-90-2

Carbonylbisdioxomethyloxadiazolidine

Description:

Carbonylbisdioxomethyloxadiazolidine, identified by its CAS number 115491-90-2, is a chemical compound that features a unique structure characterized by the presence of a carbonyl group and dioxo functional groups within a methyloxadiazolidine framework. This compound is part of a class of heterocyclic compounds, which typically exhibit interesting chemical reactivity due to the presence of nitrogen and oxygen atoms in their rings. The oxadiazolidine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as such compounds often display biological activity. Additionally, the presence of multiple functional groups may contribute to its reactivity and interaction with other chemical species. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit moderate stability under standard conditions but may be sensitive to changes in pH or the presence of strong oxidizing agents. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₇H₆N₄O₇

InChI: InChI=1/C7H6N4O7/c1-8-3(12)10(17-6(8)15)5(14)11-4(13)9(2)7(16)18-11/h1-2H3

SMILES: Cn1c(=O)n(C(=O)n2c(=O)n(C)c(=O)o2)oc1=O

Synonyms:

• 2,2-Carbonylbis(3,5-dioxo-4-methyl-1,2,4-oxadiazolidine)
• 2,2'-Carbonylbis(4-Methyl-1,2,4-Oxadiazolidine-3,5-Dione)

2,2'-Carbonylbis(3,5-dioxo-4-methyl-1,2,4-oxadiazolidine)

CAS: 115491-90-2

Formula: C₇H₆N₄O₇

Molecular weight: 258.1451

Ref: IN-DA000G2J