CymitQuimica logo

CAS 1155-48-2

:

2-(benzoylamino)-3-phenylprop-2-enoic acid

Description:
2-(Benzoylamino)-3-phenylprop-2-enoic acid, also known as benzoylphenylalanine, is an organic compound characterized by its structure, which includes a benzoyl group and a phenylprop-2-enoic acid moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. It exhibits properties typical of amino acids and can participate in various chemical reactions, including acylation and condensation. The presence of both the benzoyl and phenyl groups contributes to its potential applications in pharmaceuticals and as a biochemical probe. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic purposes. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C16H13NO3
InChI:InChI=1/C16H13NO3/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12/h1-11H,(H,17,18)(H,19,20)
SMILES:c1ccc(cc1)C=C(C(=O)O)N=C(c1ccccc1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.