CAS 1155056-61-3: 3-(3-Thienyl)-1,2,4-oxadiazole-5-propanamine

Description:3-(3-Thienyl)-1,2,4-oxadiazole-5-propanamine is a chemical compound characterized by its unique structure, which includes a thienyl group and an oxadiazole ring. The presence of the oxadiazole moiety suggests potential applications in pharmaceuticals and materials science due to its heterocyclic nature, which often imparts interesting electronic and photophysical properties. The thienyl group contributes to the compound's aromatic character, enhancing its stability and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the propanamine side chain can influence solubility and interaction with biological targets. The compound's properties, such as melting point, solubility, and reactivity, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 3-(3-Thienyl)-1,2,4-oxadiazole-5-propanamine represents a versatile structure with potential applications in various fields, including organic synthesis and drug development.

Formula:C₉H₁₁N₃OS

InChI:InChI=1S/C9H11N3OS/c10-4-1-2-8-11-9(12-13-8)7-3-5-14-6-7/h3,5-6H,1-2,4,10H2

InChI key:InChIKey=JQGYHDSBXQBTQZ-UHFFFAOYSA-N

SMILES:N=1OC(=NC1C2=CSC=C2)CCCN