CAS 115506-09-7

1,4-Cyclohexanedimethanol, dimethanesulfonate, trans-

Description:

1,4-Cyclohexanedimethanol, dimethanesulfonate, trans- is a chemical compound characterized by its structure, which includes a cyclohexane ring with two methanol groups attached at the 1 and 4 positions, along with dimethanesulfonate groups. This compound is typically used in various applications, including as a chemical intermediate in the synthesis of polymers and other organic compounds. Its sulfonate groups enhance its solubility in polar solvents, making it useful in formulations requiring improved solubility and stability. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, which can influence the compound's physical properties, such as melting and boiling points, as well as its reactivity. Additionally, the presence of sulfonate groups may impart certain ionic characteristics, affecting its behavior in solution. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and functional properties.

Formula: C₁₀H₂₀O₆S₂

InChI: InChI=1/C10H20O6S2/c1-17(11,12)15-7-9-3-5-10(6-4-9)8-16-18(2,13)14/h9-10H,3-8H2,1-2H3/t9-,10-

InChI key: InChIKey=CNTVUGYMAHTWKS-MGCOHNPYNA-N

SMILES: C(OS(C)(=O)=O)[C@H]1CC[C@H](COS(C)(=O)=O)CC1

Synonyms:

• 1,4-Cyclohexanedimethanol, dimethanesulfonate, trans-

1,4-Cyclohexanedimethanol, dimethanesulfonate, trans- (9CI)

CAS: 115506-09-7

Formula: C₁₀H₂₀O₆S₂

Molecular weight: 300.3922

Ref: IN-DA000G32