
CAS 1155264-47-3
:1-Bromo-2-fluoro-4-(fluoromethyl)benzene
Description:
1-Bromo-2-fluoro-4-(fluoromethyl)benzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a fluoromethyl group attached to a benzene ring. This compound features a bromine substituent at the first position, a fluorine at the second position, and a fluoromethyl group at the fourth position of the benzene ring, contributing to its unique reactivity and properties. The presence of multiple halogen atoms enhances its potential for electrophilic substitution reactions and influences its physical properties, such as boiling and melting points, which are typically higher than those of non-halogenated benzene derivatives. Additionally, the compound's fluorine atoms can impart increased lipophilicity and stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its molecular structure suggests that it may exhibit interesting electronic properties, potentially making it useful in materials science and organic synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose health and environmental risks.
Formula:C7H5BrF2
InChI:InChI=1S/C7H5BrF2/c8-6-2-1-5(4-9)3-7(6)10/h1-3H,4H2
InChI key:InChIKey=MMWIZPGMANAOLA-UHFFFAOYSA-N
SMILES:C(F)C1=CC(F)=C(Br)C=C1
Synonyms:- 1-Bromo-2-fluoro-4-(fluoromethyl)benzene
- Benzene, 1-bromo-2-fluoro-4-(fluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.