
CAS 1155270-68-0
:8-Bromo-4-(2-hydroxyethyl)-5-methoxy-2(1H)-quinolinone
Description:
8-Bromo-4-(2-hydroxyethyl)-5-methoxy-2(1H)-quinolinone is a synthetic organic compound characterized by its quinolinone structure, which features a bromine atom at the 8-position and a methoxy group at the 5-position. The presence of a hydroxyethyl group at the 4-position contributes to its solubility and potential reactivity. This compound is typically used in medicinal chemistry and may exhibit biological activity, potentially serving as a scaffold for drug development. Its molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, influencing its interactions with biological targets. The bromine substituent can also enhance the compound's lipophilicity and may play a role in its pharmacological properties. As with many quinolinone derivatives, it may possess antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C12H12BrNO3
InChI:InChI=1S/C12H12BrNO3/c1-17-9-3-2-8(13)12-11(9)7(4-5-15)6-10(16)14-12/h2-3,6,15H,4-5H2,1H3,(H,14,16)
InChI key:InChIKey=ZMPHTSPMQRXDRE-UHFFFAOYSA-N
SMILES:C(CO)C=1C=2C(=C(Br)C=CC2OC)NC(=O)C1
Synonyms:- 8-Bromo-4-(2-hydroxyethyl)-5-methoxyquinolin-2(1H)-one
- 2(1H)-Quinolinone, 8-bromo-4-(2-hydroxyethyl)-5-methoxy-
- 8-Bromo-4-(2-hydroxyethyl)-5-methoxy-2(1H)-quinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.