
CAS 1155354-15-6
:2,5-Dibromo-4-fluorophenol
Description:
2,5-Dibromo-4-fluorophenol is an organic compound characterized by the presence of two bromine atoms and one fluorine atom attached to a phenolic ring. This compound features a hydroxyl (-OH) group, which contributes to its classification as a phenol. The bromine substituents are located at the 2 and 5 positions, while the fluorine is at the 4 position of the aromatic ring. This specific arrangement can influence the compound's reactivity, solubility, and potential applications in various chemical processes. Generally, halogenated phenols exhibit unique properties such as increased lipophilicity and altered biological activity compared to their non-halogenated counterparts. The presence of multiple halogens can also enhance the compound's stability and resistance to degradation. 2,5-Dibromo-4-fluorophenol may be utilized in research and industrial applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C6H3Br2FO
InChI:InChI=1S/C6H3Br2FO/c7-3-2-6(10)4(8)1-5(3)9/h1-2,10H
InChI key:InChIKey=FPIGGOMOPPIKOP-UHFFFAOYSA-N
SMILES:BrC1=C(F)C=C(Br)C(O)=C1
Synonyms:- Phenol, 2,5-dibromo-4-fluoro-
- 2,5-Dibromo-4-fluorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.