CAS 1155361-00-4

α-(2,4-Difluorophenyl)-α-[[[(2-fluorophenyl)methyl]-2-propen-1-ylamino]methyl]-1H-1,2,4-triazole-1-ethanol

Description:

α-(2,4-Difluorophenyl)-α-[[[(2-fluorophenyl)methyl]-2-propen-1-ylamino]methyl]-1H-1,2,4-triazole-1-ethanol, with CAS number 1155361-00-4, is a chemical compound characterized by its complex structure, which includes a triazole ring and multiple fluorinated phenyl groups. This compound typically exhibits properties associated with triazole derivatives, such as potential antifungal or herbicidal activity, due to the presence of the triazole moiety, which is known for its ability to inhibit specific enzymes in target organisms. The presence of fluorine atoms in the phenyl groups can enhance lipophilicity and metabolic stability, potentially affecting the compound's bioactivity and pharmacokinetics. Additionally, the compound's structure suggests it may engage in hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Overall, this compound's unique combination of functional groups and substituents positions it as a candidate for further research in medicinal chemistry and agrochemical applications.

Formula: C₂₁H₂₁F₃N₄O

InChI: InChI=1S/C21H21F3N4O/c1-2-9-27(11-16-5-3-4-6-19(16)23)12-21(29,13-28-15-25-14-26-28)18-8-7-17(22)10-20(18)24/h2-8,10,14-15,29H,1,9,11-13H2

InChI key: InChIKey=KYEYNJPZPOQCKF-UHFFFAOYSA-N

SMILES: C(CN(CC1=C(F)C=CC=C1)CC=C)(CN2C=NC=N2)(O)C3=C(F)C=C(F)C=C3

Synonyms:

• 1H-1,2,4-Triazole-1-ethanol, α-(2,4-difluorophenyl)-α-[[[(2-fluorophenyl)methyl]-2-propen-1-ylamino]methyl]-
• α-(2,4-Difluorophenyl)-α-[[[(2-fluorophenyl)methyl]-2-propen-1-ylamino]methyl]-1H-1,2,4-triazole-1-ethanol

Cytochrome P450 14a-demethylase inhibitor 1B

CAS: 1155361-00-4

Cytochrome P450 14a-demethylase inhibitor 1B is a Research Tool in Cell Biology, Pharmacology, Ion channels, Receptor, Ligand, Peptides. This is a Cytochrome P450 14a-demethylase inhibitor 1B. It's a high purity inhibitor of Cytochrome P450 14a-demethylase. It can be used as an immunogen or to raise antibodies against Cytochrome P450 14a-demethylase.

Formula: C₂₁H₂₁F₃N₄O

Purity: Min. 95%

Molecular weight: 402.4 g/mol

Ref: 3D-FWB36100