CAS 115538-85-7: 7α-Hydroxy-3-oxo-4-cholestenoic acid
Description:7α-Hydroxy-3-oxo-4-cholestenoic acid, with the CAS number 115538-85-7, is a steroid compound that plays a significant role in the metabolism of cholesterol and bile acids. It is characterized by a hydroxyl group at the 7α position and a keto group at the 3 position of the steroid nucleus, which contributes to its biological activity. This compound is involved in various biochemical pathways, particularly in the regulation of cholesterol homeostasis and the synthesis of bile acids. Its structure features a steroid backbone, which is typical of many biologically active molecules, and it exhibits hydrophobic properties due to its steroidal nature. The presence of functional groups such as hydroxyl and keto enhances its solubility in polar solvents, influencing its interaction with biological membranes and enzymes. Research indicates that it may have implications in metabolic disorders and could serve as a potential biomarker or therapeutic target in cholesterol-related diseases.
Formula:C27H42O4
InChI:InChI=1S/C27H42O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h14,16-17,20-24,29H,5-13,15H2,1-4H3,(H,30,31)/t16-,17?,20-,21+,22+,23-,24+,26+,27-/m1/s1
InChI key:InChIKey=SATGKQGFUDXGAX-MYWFJNCASA-N
SMILES:O=C1C=C2CC(O)C3C(CCC4(C)C(CCC34)C(C)CCCC(C(=O)O)C)C2(C)CC1
- Synonyms:
- (7Alpha)-7-Hydroxy-3-Oxocholest-4-En-26-Oic Acid
- (7α)-7-Hydroxy-3-oxocholest-4-en-26-oic acid
- 7 Alpha-Hydroxy-3-Oxo-4-Cholestenoic Acid
- 7α-Hydroxy-3-oxo-4-cholestenoic acid
- 7α-Hydroxy-3-oxocholest-4-en-26-oic acid
- Cholest-4-en-26-oic acid, 7-hydroxy-3-oxo-, (7α)-
