CAS 115540-88-0
:2-(2,3-DICHLOROPHENOXY)THIOACETAMIDE
Description:
2-(2,3-Dichlorophenoxy)thioacetamide is a chemical compound characterized by its unique structure, which includes a thioacetamide functional group and a dichlorophenoxy moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of chlorine atoms in the phenoxy group enhances its biological activity, making it a subject of interest in studies related to herbicides or fungicides. The thioacetamide group contributes to its reactivity, allowing for potential interactions with biological systems. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Its specific properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other substances. Overall, 2-(2,3-Dichlorophenoxy)thioacetamide is a compound of interest due to its chemical characteristics and potential applications.
Formula:C8H7Cl2NOS
InChI:InChI=1/C8H7Cl2NOS/c9-5-2-1-3-6(8(5)10)12-4-7(11)13/h1-3H,4H2,(H2,11,13)
SMILES:c1cc(c(c(c1)OCC(=N)S)Cl)Cl
Synonyms:- 2-(2,3-Dichlorophenoxy)ethanethioamide
- Ethanethioamide, 2-(2,3-Dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
