CymitQuimica logo

CAS 115542-00-2

:

N-(3-Hydroxy-2-pyridinyl)-N′-phenylurea

Description:
N-(3-Hydroxy-2-pyridinyl)-N′-phenylurea, with the CAS number 115542-00-2, is a chemical compound characterized by its urea functional group, which is linked to a phenyl group and a pyridine derivative. This compound typically exhibits properties associated with both the urea and pyridine moieties, including potential solubility in polar solvents due to the presence of the hydroxyl group. It may display biological activity, making it of interest in pharmaceutical research, particularly in the context of its potential as a therapeutic agent. The presence of the hydroxyl group can influence its reactivity and interactions with biological targets. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl and urea functionalities, affecting its physical properties such as melting point and boiling point. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(3-Hydroxy-2-pyridinyl)-N′-phenylurea represents a class of compounds that may have diverse applications in medicinal chemistry and related fields.
Formula:C12H11N3O2
InChI:InChI=1S/C12H11N3O2/c16-10-7-4-8-13-11(10)15-12(17)14-9-5-2-1-3-6-9/h1-8,16H,(H2,13,14,15,17)
InChI key:InChIKey=MUTZXOUXSQXRGW-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=O)C2=C(O)C=CC=N2
Synonyms:
  • Urea, N-(3-hydroxy-2-pyridinyl)-N′-phenyl-
  • 1-(3-Hydroxypyridin-2-yl)-3-phenylurea
  • N-(3-Hydroxy-2-pyridinyl)-N′-phenylurea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.