CymitQuimica logo

CAS 115548-15-7

:

(R)-4-(3-AMINO-BUTYL)-PHENOL

Description:
(R)-4-(3-Amino-butyl)-phenol, with the CAS number 115548-15-7, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a 3-amino-butyl side chain contributes to its potential biological activity and solubility properties. This compound is typically a chiral molecule, with the (R) designation indicating the specific spatial arrangement of its atoms, which can influence its interaction with biological systems and receptors. It may exhibit properties such as being a potential intermediate in organic synthesis or a building block for pharmaceuticals. The amino group can participate in hydrogen bonding and may enhance the compound's reactivity and solubility in polar solvents. Additionally, the phenolic hydroxyl group can act as an antioxidant, suggesting potential applications in medicinal chemistry or materials science. Overall, (R)-4-(3-amino-butyl)-phenol is of interest in various fields, including drug development and chemical research, due to its unique structural features and functional groups.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-8,12H,2-3,11H2,1H3/t8-/m1/s1
Synonyms:
  • (R)-2-AMINO-4-(4-HYDROXYPHENYL)BUTANE
  • 4-[(3R)-3-aminobutyl]phenol
  • (R)-1-METHYL-3-(P-HYDROXY-PHENYL)-PROPYLAMINE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.