CAS 115549-05-8
:2,3,4-Trichloro-5-fluorobenzoyl chloride
Description:
2,3,4-Trichloro-5-fluorobenzoyl chloride is an organic compound characterized by its chlorinated and fluorinated aromatic structure. It features a benzoyl chloride moiety, which includes a carbonyl group attached to a benzene ring, along with three chlorine atoms and one fluorine atom substituted on the aromatic ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly as an acylating agent, making it useful in various synthetic applications, including the production of pharmaceuticals and agrochemicals. The presence of multiple halogen substituents enhances its electrophilic character, allowing it to participate in nucleophilic substitution reactions. Due to its chemical properties, it may pose hazards such as toxicity and environmental concerns, necessitating careful handling and storage. As with many chlorinated compounds, it may also exhibit stability under certain conditions, but can decompose or react under specific circumstances, particularly when exposed to moisture or reactive nucleophiles.
Formula:C7HCl4FO
InChI:InChI=1S/C7HCl4FO/c8-4-2(7(11)13)1-3(12)5(9)6(4)10/h1H
InChI key:InChIKey=WXAUBUZVERZUSH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(Cl)C(Cl)=C(Cl)C(F)=C1
Synonyms:- 2,3,4-Trichloro-5-Fluorobenzoyl Chloride
- 2,3,4-Trichloro-5-fluorobenzoic acid chloride
- 5-Fluoro-2,3,4-trichlorobenzoyl chloride
- Benzoyl Chloride, 2,3,4-Trichloro-5-Fluoro-
- 2,3,4-Trichloro-5-fluorobenzoic chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4-Trichloro-5-fluorobenzoic chloride
CAS:2,3,4-Trichloro-5-fluorobenzoic chloride (TCFB) is a sulfuryl chloride that is used as a herbicide. TCFB is hydrolyzed by carboxylates in the soil to form formic acid and hydrochloric acid. The hydrolysis of TCFB makes it selective for the roots of plants. TCFB can also be chlorinated to regenerate the acid and then recycled. Hydrolyzing TCFB allows it to be selectively applied on plant roots without affecting any other part of the plant. The presence of chlorine in this compound allows for its use as an insecticide and fumigant.Formula:C7HCl4FOPurity:Min. 95%Molecular weight:261.89 g/mol

