
CAS 115549-14-9
:2,4,5-Trifluoro-3-nitrobenzoyl fluoride
Description:
2,4,5-Trifluoro-3-nitrobenzoyl fluoride is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with three fluorine atoms and a nitro group, along with a fluorinated acyl group. This compound is typically a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the acyl fluoride functional group, which can participate in nucleophilic substitution reactions. The trifluoromethyl groups enhance its electrophilic character, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. Additionally, the nitro group contributes to its potential as a building block in organic synthesis. Safety precautions are necessary when handling this compound, as it may be toxic and can release harmful gases upon decomposition. Overall, 2,4,5-Trifluoro-3-nitrobenzoyl fluoride is a valuable intermediate in the synthesis of more complex fluorinated organic molecules.
Formula:C7HF4NO3
InChI:InChI=1S/C7HF4NO3/c8-3-1-2(7(11)13)4(9)6(5(3)10)12(14)15/h1H
InChI key:InChIKey=DNSOMNRVVDQOTA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C(C(F)=O)=CC(F)=C1F
Synonyms:- Benzoyl fluoride, 2,4,5-trifluoro-3-nitro-
- 2,4,5-Trifluoro-3-nitrobenzoyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
