CAS 115551-85-4
:5-Nitro-4-(trifluoromethyl)-2(1H)-pyridinone
Description:
5-Nitro-4-(trifluoromethyl)-2(1H)-pyridinone, with the CAS number 115551-85-4, is a heterocyclic organic compound characterized by a pyridinone structure that incorporates both a nitro group and a trifluoromethyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its polar nature due to the presence of the nitro group. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential as a building block for more complex molecules. Its unique functional groups may impart specific pharmacological properties, making it a candidate for further research in drug development. Additionally, the presence of fluorine atoms often contributes to the stability and metabolic resistance of the compound in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H3F3N2O3
InChI:InChI=1S/C6H3F3N2O3/c7-6(8,9)3-1-5(12)10-2-4(3)11(13)14/h1-2H,(H,10,12)
InChI key:InChIKey=YJIBBNRJEMAXGL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(N(=O)=O)=CNC(=O)C1
Synonyms:- 2(1H)-Pyridinone, 5-nitro-4-(trifluoromethyl)-
- 5-Nitro-4-(trifluoromethyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.