CAS 115562-30-6
:S-phosphocysteine
Description:
S-Phosphocysteine is a phosphorylated derivative of the amino acid cysteine, characterized by the presence of a phosphate group attached to the sulfur atom of the cysteine side chain. This modification enhances its biochemical properties, making it an important molecule in various biological processes, particularly in cellular signaling and metabolism. S-Phosphocysteine is known to play a role in the regulation of protein function through post-translational modifications, influencing pathways such as redox signaling and cellular stress responses. It is soluble in water, which facilitates its interaction with other biomolecules in aqueous environments. The compound is often studied in the context of its potential implications in health and disease, particularly in relation to oxidative stress and neurodegenerative disorders. Additionally, S-phosphocysteine can serve as a precursor for the synthesis of other biologically relevant molecules, contributing to its significance in biochemical research. Overall, its unique structure and functional properties make S-phosphocysteine a valuable subject of study in the fields of biochemistry and molecular biology.
Formula:C3H8NO5PS
InChI:InChI=1/C3H8NO5PS/c4-2(3(5)6)1-11-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1
InChI key:InChIKey=MNEMQJJMDDZXRO-REOHCLBHSA-N
SMILES:C([C@@H](C(O)=O)N)SP(=O)(O)O
Synonyms:- (2R)-2-Amino-3-(phosphonosulfanyl)propanoic acid
- <span class="text-smallcaps">L</span>-Cysteine, S-phosphono-
- <span class="text-smallcaps">L</span>-Cysteine, dihydrogen phosphate (ester)
- L-Cysteine, dihydrogen phosphate (ester)
- S-Phospho-<span class="text-smallcaps">L</span>-cysteine
- S-Phosphono-<span class="text-smallcaps">L</span>-cysteine
- S-phosphono-L-cysteine
- S-Phosphocysteine
- S-Phospho-L-cysteine
- L-Cysteine, S-phosphono-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
