CAS 1155662-43-3

rel-Methyl (3R,5R)-5-methyl-3-piperidinecarboxylate

Description:

Rel-Methyl (3R,5R)-5-methyl-3-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The compound features a methyl ester functional group, indicating that it is an ester derived from a carboxylic acid and methanol. The stereochemistry of the molecule is defined by the (3R,5R) configuration, which refers to the specific spatial arrangement of the substituents around the chiral centers at the 3rd and 5th positions of the piperidine ring. This stereochemistry can significantly influence the compound's biological activity and interactions. The presence of the methyl group at the 5th position contributes to its overall hydrophobic character, which may affect its solubility and permeability in biological systems. As a piperidine derivative, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation and research.

Formula: C₈H₁₅NO₂

InChI: InChI=1/C8H15NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h6-7,9H,3-5H2,1-2H3/t6-,7-/s2

InChI key: InChIKey=HJPYJRXRHXOATI-WZTWBHKBNA-N

SMILES: C(OC)(=O)[C@H]1C[C@H](C)CNC1

Synonyms:

• rel-Methyl (3R,5R)-5-methyl-3-piperidinecarboxylate
• 3-Piperidinecarboxylic acid, 5-methyl-, methyl ester, (3R,5R)-rel-