CAS 115575-11-6
:Liarozole
Description:
Liarozole is a synthetic compound primarily recognized for its role as an aromatase inhibitor, which means it inhibits the enzyme aromatase that converts androgens to estrogens. This characteristic makes liarozole significant in the context of hormone-related conditions, particularly in the treatment of certain types of breast cancer and other estrogen-dependent disorders. The chemical structure of liarozole includes a pyridine ring, contributing to its pharmacological properties. It is typically administered in a pharmaceutical context and has been studied for its potential effects on hormone levels and its therapeutic applications. Additionally, liarozole has been investigated for its influence on various metabolic pathways, including those related to cholesterol and steroid hormone synthesis. As with many pharmacological agents, the efficacy and safety profile of liarozole are determined through clinical studies, and it is essential to consider potential side effects and interactions with other medications when evaluating its use in treatment regimens.
Formula:C17H14Cl2N4
InChI:InChI=1/C17H13ClN4.ClH/c18-14-3-1-2-12(8-14)17(22-7-6-19-11-22)13-4-5-15-16(9-13)21-10-20-15;/h1-11,17H,(H,20,21);1H
InChI key:InChIKey=UGFHIPBXIWJXNA-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)Cl)C(c1ccc2c(c1)[nH]cn2)n1ccnc1.Cl
Synonyms:- 1H-Benzimidazole, 5-((3-chlorophenyl)-1H-imidazol-1-ylmethyl)-
- 1H-Benzimidazole, 6-[(3-chlorophenyl)-1H-imidazol-1-ylmethyl]-
- 6-[(3-Chlorophenyl)-1H-imidazol-1-ylmethyl]-1H-benzimidazole
- 6-[(3-chlorophenyl)(1H-imidazol-1-yl)methyl]-1H-benzimidazole
- 6-[(3-chlorophenyl)(1H-imidazol-1-yl)methyl]-1H-benzimidazole hydrochloride (1:1)
- Liarozol
- Liarozol [INN-Spanish]
- Liarozole [INN:BAN]
- Liarozolum
- Liarozolum [INN-Latin]
- R 61405
- R 75251
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Liarozole
CAS:Liarozole dihydrochloride inhibits CYP450, estrogen, androgen synthesis; an oral drug for prostate cancer/skin disorders.Formula:C17H13ClN4Purity:98.31%Color and Shape:SolidMolecular weight:308.76Ref: TM-T11847L
1mg57.00€5mg120.00€10mg187.00€25mg369.00€50mg588.00€100mg938.00€1mL*10mM (DMSO)133.00€1H-Benzimidazole, 6-[(3-chlorophenyl)-1H-imidazol-1-ylmethyl]-
CAS:Formula:C17H13ClN4Purity:98%Color and Shape:SolidMolecular weight:308.7649Liarozole
CAS:<p>Liarozole is an imidazole derivative that functions as a non-specific inhibitor of cytochrome P450-dependent retinoic acid metabolism. It primarily acts by inhibiting the cytochrome P450 enzyme family, particularly affecting the 4-hydroxylation process. This inhibition increases the local concentration of retinoic acid in tissues, which can lead to a modulation of transcriptional activity by retinoic acid receptors and ultimately influence cellular proliferation and differentiation.</p>Formula:C17H13ClN4Purity:Min. 95%Molecular weight:308.8 g/mol



