CAS 115584-75-3

L-Glutamine, hydrate (1:1)

Description:

L-Glutamine, hydrate (1:1), with the CAS number 115584-75-3, is a naturally occurring amino acid that plays a crucial role in various metabolic processes. It is classified as a non-essential amino acid, meaning that the body can synthesize it, although it can also be obtained from dietary sources. In its hydrated form, L-Glutamine typically exists as a white crystalline powder, which is soluble in water, making it suitable for various applications in biochemistry and nutrition. This compound is particularly important in cellular metabolism, serving as a nitrogen donor in the synthesis of nucleotides and amino acids. Additionally, L-Glutamine is known for its role in supporting immune function and gut health, as it serves as a primary fuel source for enterocytes in the intestines. Its stability and solubility make it a valuable ingredient in dietary supplements, particularly for athletes and individuals undergoing stress or illness, as it may help in recovery and muscle maintenance.

Formula: C₅H₁₀N₂O₃·H₂O

InChI: InChI=1S/C5H10N2O3.H2O/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H2,7,8)(H,9,10);1H2/t3-;/m0./s1

InChI key: InChIKey=OQWQUUUQDAYNKF-DFWYDOINSA-N

SMILES: [C@H](CCC(N)=O)(C(O)=O)N.O

Synonyms:

• L-Glutamine, hydrate (1:1)
• L-Glutamine, monohydrate