CAS 115595-28-3
:4-(5-Hexen-1-yloxy)benzoic acid
Description:
4-(5-Hexen-1-yloxy)benzoic acid, with the CAS number 115595-28-3, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the 5-hexen-1-yloxy group introduces a long carbon chain with a double bond, enhancing its hydrophobic characteristics and potentially influencing its reactivity and solubility in organic solvents. This compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Its structure suggests potential applications in organic synthesis, particularly in the development of polymers or as intermediates in the synthesis of more complex molecules. Additionally, the presence of both hydrophilic (carboxylic acid) and hydrophobic (alkene) components may allow for interesting interactions in biological systems or materials science. Overall, 4-(5-Hexen-1-yloxy)benzoic acid is a versatile compound with potential utility in various chemical applications.
Formula:C13H16O3
InChI:InChI=1S/C13H16O3/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h2,6-9H,1,3-5,10H2,(H,14,15)
InChI key:InChIKey=IBSMHZIMQAHZSK-UHFFFAOYSA-N
SMILES:O(CCCCC=C)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-(5-Hexen-1-yloxy)benzoic acid
- Benzoic acid, 4-(5-hexenyloxy)-
- Benzoic acid, 4-(5-hexen-1-yloxy)-
- 4-(Hex-5-enoxy)benzoic acid
- 4-(5-Hexenyloxy)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
