CAS 115595-31-8
:4-(9-Decen-1-yloxy)benzoic acid
Description:
4-(9-Decen-1-yloxy)benzoic acid is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with a long-chain aliphatic ether. The presence of the 9-decenyloxy group indicates that it has a long hydrocarbon chain with a double bond, contributing to its hydrophobic properties. This compound typically exhibits amphiphilic characteristics, making it useful in various applications, including surfactants and emulsifiers. Its molecular structure suggests potential interactions with biological membranes, which could be relevant in pharmaceutical or biochemical contexts. The carboxylic acid functional group provides acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound may display unique thermal and solubility characteristics due to the combination of the hydrophilic carboxylic acid and the hydrophobic alkyl chain. Overall, 4-(9-Decen-1-yloxy)benzoic acid is notable for its potential applications in materials science and biochemistry, particularly in the development of novel surfactants or drug delivery systems.
Formula:C17H24O3
InChI:InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19/h2,10-13H,1,3-9,14H2,(H,18,19)
InChI key:InChIKey=GVRFHEQRUXQBQL-UHFFFAOYSA-N
SMILES:O(CCCCCCCCC=C)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-(9-Decenyloxy)benzoic acid
- Benzoic acid, 4-(9-decen-1-yloxy)-
- 4-(Dec-9-enoxy)benzoic acid
- 4-(9-Decen-1-yloxy)benzoic acid
- Benzoic acid, 4-(9-decenyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
