CymitQuimica logo

CAS 115596-48-0

:

4-(2,2-dimethyltetrahydro-2H-pyran-4-yl)-1H-pyrazole-3,5-diamine

Description:
4-(2,2-Dimethyltetrahydro-2H-pyran-4-yl)-1H-pyrazole-3,5-diamine is an organic compound characterized by its unique structural features, which include a pyrazole ring and a tetrahydropyran moiety. The presence of the pyrazole ring contributes to its potential biological activity, as pyrazoles are known for their diverse pharmacological properties. The compound contains two amino groups, which can participate in hydrogen bonding and may enhance its solubility in polar solvents. The dimethyl substitution on the tetrahydropyran ring adds steric bulk, potentially influencing the compound's reactivity and interaction with biological targets. This substance may exhibit properties such as moderate to high polarity, depending on the functional groups present, and could be of interest in medicinal chemistry for the development of new therapeutic agents. Its CAS number, 115596-48-0, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H18N4O
InChI:InChI=1/C10H18N4O/c1-10(2)5-6(3-4-15-10)7-8(11)13-14-9(7)12/h6H,3-5H2,1-2H3,(H5,11,12,13,14)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.