
CAS 1156042-40-8
:N-Methyl-N-(4-pyridinylmethyl)-β-alanine
Description:
N-Methyl-N-(4-pyridinylmethyl)-β-alanine is a chemical compound characterized by its unique structure, which includes a β-alanine backbone modified with a methyl group and a pyridinylmethyl substituent. This compound features a pyridine ring, which contributes to its potential biological activity and interaction with various receptors or enzymes. The presence of the N-methyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a β-alanine derivative, it may exhibit properties similar to other amino acids, such as participating in peptide synthesis or acting as a neurotransmitter modulator. The compound's molecular interactions can be significant in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Its specific applications and biological effects would depend on further research, including studies on its solubility, stability, and interaction with biological systems. Overall, N-Methyl-N-(4-pyridinylmethyl)-β-alanine represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-12(7-4-10(13)14)8-9-2-5-11-6-3-9/h2-3,5-6H,4,7-8H2,1H3,(H,13,14)
InChI key:InChIKey=UNVITKXYWWBWJQ-UHFFFAOYSA-N
SMILES:C(N(CCC(O)=O)C)C=1C=CN=CC1
Synonyms:- N-Methyl-N-(4-pyridinylmethyl)-β-alanine
- β-Alanine, N-methyl-N-(4-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.