CAS 1156158-03-0

1-[4-(Dimethylamino)-1-piperidinyl]-2-propen-1-one

Description:

1-[4-(Dimethylamino)-1-piperidinyl]-2-propen-1-one, also known by its CAS number 1156158-03-0, is an organic compound characterized by its unique structure that includes a piperidine ring and a propenone moiety. This compound typically exhibits properties associated with both amines and ketones, which can influence its reactivity and interactions. The presence of the dimethylamino group suggests it may exhibit basic characteristics, potentially allowing it to participate in various chemical reactions, including nucleophilic attacks. Additionally, the propenone structure indicates that it may undergo conjugate addition reactions or polymerization under certain conditions. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₁₀H₁₈N₂O

InChI: InChI=1S/C10H18N2O/c1-4-10(13)12-7-5-9(6-8-12)11(2)3/h4,9H,1,5-8H2,2-3H3

InChI key: InChIKey=YLXQICVLZWJHGZ-UHFFFAOYSA-N

SMILES: C(C=C)(=O)N1CCC(N(C)C)CC1

Synonyms:

• 1-[4-(Dimethylamino)-1-piperidinyl]-2-propen-1-one
• 2-Propen-1-one, 1-[4-(dimethylamino)-1-piperidinyl]-