CAS 115616-51-8: S-(2-thiopyridyl)mercaptopropionohydrazide
Description:S-(2-thiopyridyl)mercaptopropionohydrazide is a chemical compound characterized by its unique structure, which includes a thiopyridine moiety and a hydrazide functional group. This compound typically exhibits properties associated with both thiols and hydrazides, including potential reactivity towards electrophiles and the ability to form coordination complexes with metal ions. Its mercapto group contributes to its nucleophilicity, making it useful in various chemical reactions, including those involving metal chelation. The presence of the thiopyridyl group may impart specific electronic and steric properties, influencing its behavior in biological and chemical systems. Additionally, this compound may exhibit biological activity, potentially serving as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, S-(2-thiopyridyl)mercaptopropionohydrazide is a versatile compound with potential applications in medicinal chemistry, materials science, and coordination chemistry.
Formula:C8H11N3OS2
InChI:InChI=1/C8H11N3OS2/c9-11-7(12)4-6-13-14-8-3-1-2-5-10-8/h1-3,5H,4,6,9H2,(H,11,12)
- Synonyms:
- 3-(2-Pyridyldithio)propionic acid hydrazide
- Tpmph
- Propanoic acid, 3-(2-pyridinyldithio)-, hydrazide
- 3-(Pyridin-2-Yldisulfanyl)Propanehydrazide
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Propanoic acid, 3-(2-pyridinyldithio)-, hydrazide REF: IN-DA000G9CCAS: 115616-51-8 | 95% | 107.00 €~339.00 € | Thu 27 Mar 25 |
 | PDPH Crosslinker REF: TM-T33904CAS: 115616-51-8 | - - - | 313.00 €~1,374.00 € | Fri 28 Mar 25 |
 | 3-(Pyridin-2-yldisulfanyl)propanehydrazide REF: 10-F606464CAS: 115616-51-8 | 95% | To inquire | Tue 08 Apr 25 |
 | 3-(2-Pyridyldithio)propanoic acid hydrazide REF: 3D-FP27338CAS: 115616-51-8 | Min. 95% | - - - | Discontinued product |
Propanoic acid, 3-(2-pyridinyldithio)-, hydrazide
Ref: IN-DA000G9C
| 1g | 339.00 € | ||
| 100mg | 107.00 € | ||
| 250mg | 171.00 € |
PDPH Crosslinker
Ref: TM-T33904
| 1g | 1,374.00 € | ||
| 100mg | 313.00 € |
3-(Pyridin-2-yldisulfanyl)propanehydrazide
Ref: 10-F606464
| 1g | To inquire | ||
| 100mg | To inquire | ||
| 250mg | To inquire |
3-(2-Pyridyldithio)propanoic acid hydrazide
Ref: 3D-FP27338
| 1mg | Discontinued | Request information | |
| 2mg | Discontinued | Request information | |
| 5mg | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information |
