CymitQuimica logo

CAS 1156220-86-8

:

4-(Hydroxymethyl)-1-piperidineethanol

Description:
4-(Hydroxymethyl)-1-piperidineethanol, identified by its CAS number 1156220-86-8, is an organic compound characterized by a piperidine ring with a hydroxymethyl group and an ethanol moiety. This compound typically exhibits properties associated with both amines and alcohols, making it a versatile intermediate in organic synthesis. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can influence its solubility in polar solvents and its reactivity in various chemical reactions. Additionally, the piperidine structure contributes to its basicity and potential interactions with biological systems, which may be relevant in pharmaceutical applications. The compound may also exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups present. Overall, 4-(Hydroxymethyl)-1-piperidineethanol is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C8H17NO2
InChI:InChI=1S/C8H17NO2/c10-6-5-9-3-1-8(7-11)2-4-9/h8,10-11H,1-7H2
InChI key:InChIKey=YBMMANNRSGHVEZ-UHFFFAOYSA-N
SMILES:C(CO)N1CCC(CO)CC1
Synonyms:
  • 4-(Hydroxymethyl)-1-piperidineethanol
  • 1-Piperidineethanol, 4-(hydroxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.