CAS 115627-41-3
:N-(3-INDOLYLFORMYL)-L-PHENYLALANINE
Description:
N-(3-Indolylformyl)-L-phenylalanine, with the CAS number 115627-41-3, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features an indole moiety, which is a bicyclic structure known for its aromatic properties and biological significance, particularly in the context of neurotransmitters and hormones. The compound is characterized by the presence of a formyl group attached to the indole ring, which contributes to its reactivity and potential biological activity. L-phenylalanine, an essential amino acid, is incorporated into the structure, suggesting potential roles in protein synthesis and metabolic pathways. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, N-(3-Indolylformyl)-L-phenylalanine represents a unique combination of structural features that may confer specific biological activities, warranting further investigation in biochemical and pharmaceutical research.
Formula:C18H16N2O3
InChI:InChI=1/C18H16N2O3/c21-17(14-11-19-15-9-5-4-8-13(14)15)20-16(18(22)23)10-12-6-2-1-3-7-12/h1-9,11,16,19H,10H2,(H,20,21)(H,22,23)/t16-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C(=O)O)N=C(c1c[nH]c2ccccc12)O
Synonyms:- L-Phenylalanine, N-(1H-indol-3-ylcarbonyl)-
- N-(1H-Indol-3-ylcarbonyl)-L-phenylalanine
- (2S)-2-(1H-indole-3-carbonylamino)-3-phenyl-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
