
CAS 1156277-55-2
:4-Chloro-2-ethyl-6-fluoroquinoline
Description:
4-Chloro-2-ethyl-6-fluoroquinoline is a synthetic organic compound belonging to the quinoline class, characterized by a bicyclic structure that includes a nitrogen atom in its aromatic system. This compound features a chloro group at the 4-position, an ethyl group at the 2-position, and a fluoro group at the 6-position of the quinoline ring. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen substituents can influence the compound's lipophilicity, reactivity, and interaction with biological targets. Additionally, 4-Chloro-2-ethyl-6-fluoroquinoline may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. As with many quinoline derivatives, it is essential to handle this compound with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C11H9ClFN
InChI:InChI=1S/C11H9ClFN/c1-2-8-6-10(12)9-5-7(13)3-4-11(9)14-8/h3-6H,2H2,1H3
InChI key:InChIKey=KERQWJFADHBDJQ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(CC)C1)C=CC(F)=C2
Synonyms:- 4-Chloro-2-ethyl-6-fluoroquinoline
- Quinoline, 4-chloro-2-ethyl-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.