CAS 115651-77-9
:N,N-dibutyl-L-norephedrine
Description:
N,N-Dibutyl-L-norephedrine is a chemical compound that belongs to the class of sympathomimetic amines, which are known for their stimulant properties. This substance is characterized by its structural features, including a norephedrine backbone with two butyl groups attached to the nitrogen atom. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The compound exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many amines. N,N-Dibutyl-L-norephedrine is of interest in pharmacology due to its potential effects on the central nervous system and its applications in research related to adrenergic activity. As with many chemical substances, safety precautions should be taken when handling it, as it may pose risks such as irritation or toxicity. Proper storage conditions are also essential to maintain its stability and efficacy.
Formula:C17H29NO
InChI:InChI=1/C17H29NO/c1-4-6-13-18(14-7-5-2)15(3)17(19)16-11-9-8-10-12-16/h8-12,15,17,19H,4-7,13-14H2,1-3H3/t15-,17-/m0/s1
SMILES:CCCCN(CCCC)[C@@H](C)[C@@H](c1ccccc1)O
Synonyms:- (1R,2S)-2-Di-n-Butylamino-1-phenyl-1-propanol
- (1R,2S)-2-(dibutylamino)-1-phenylpropan-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(1R,2S)-2-(Dibutylamino)-1-phenylpropan-1-ol Hydrochloride
CAS:Controlled ProductApplications (1R,2S)-2-(Dibutylamino)-1-phenylpropan-1-ol (cas# 115651-77-9) is a useful research chemical.
Formula:C17H29NO·HClColor and Shape:NeatMolecular weight:299.879(1R,2S)-2-(Dibutylamino)-1-phenyl-1-propanol
CAS:Controlled Product(1R,2S)-2-(Dibutylamino)-1-phenyl-1-propanol is a chiral organic solvent that is used in the enantioselective alkylation of β-unsaturated ketones. It has been shown to be an effective catalyst for the synthesis of racemic nitromethane from aldehydes and hydride. Alkylation reactions can be used to produce other compounds such as solvents, pharmaceuticals, and fragrances. (1R,2S)-2-(Dibutylamino)-1-phenyl-1-propanol is also used as a ligand in asymmetric synthesis of β-unsaturated aldehydes and β-unsaturated ketones.Formula:C17H29NOPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:263.42 g/mol


