CAS 115651-90-6

2-[(7,7-Dimethyl-5-octyn-1-yl)oxy]tetrahydro-2H-pyran

Description:

2-[(7,7-Dimethyl-5-octyn-1-yl)oxy]tetrahydro-2H-pyran, with CAS number 115651-90-6, is an organic compound characterized by its unique structure that includes a tetrahydropyran ring and an alkynyl side chain. This compound features a tetrahydro-2H-pyran moiety, which is a six-membered cyclic ether, contributing to its potential solubility in organic solvents. The presence of the 7,7-dimethyl-5-octyn-1-yl group introduces significant steric hindrance and hydrophobic characteristics, which can influence its reactivity and interactions with other molecules. This compound may exhibit interesting chemical properties, such as potential reactivity in nucleophilic substitution reactions due to the ether functionality. Additionally, its structural features suggest potential applications in organic synthesis, particularly in the development of complex molecules or as intermediates in various chemical reactions. Overall, the combination of its cyclic ether structure and aliphatic side chain makes it a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₅H₂₆O₂

InChI: InChI=1S/C15H26O2/c1-15(2,3)11-7-4-5-8-12-16-14-10-6-9-13-17-14/h14H,4-6,8-10,12-13H2,1-3H3

InChI key: InChIKey=KNOLCORRQHQRNJ-UHFFFAOYSA-N

SMILES: O(CCCCC#CC(C)(C)C)C1CCCCO1

Synonyms:

• 2-[(7,7-Dimethyl-5-octyn-1-yl)oxy]tetrahydro-2H-pyran
• 2H-Pyran, 2-[(7,7-dimethyl-5-octynyl)oxy]tetrahydro-
• 2H-Pyran, 2-[(7,7-dimethyl-5-octyn-1-yl)oxy]tetrahydro-

2H-Pyran, 2-[(7,7-dimethyl-5-octyn-1-yl)oxy]tetrahydro-

CAS: 115651-90-6

Formula: C₁₅H₂₆O₂

Molecular weight: 238.3657

Ref: IN-DA000GOI